C20H27NO — CID 117065161
methane;1-naphthalen-2-yl-2-pyrrolidin-1-ylpentan-1-one (PubChem CID 117065161) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is methane;1-naphthalen-2-yl-2-pyrrolidin-1-ylpentan-1-one.
| Compound Name | methane;1-naphthalen-2-yl-2-pyrrolidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 117065161 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | methane;1-naphthalen-2-yl-2-pyrrolidin-1-ylpentan-1-one |
| SMILES | C.CCCC(C(=O)c1ccc2ccccc2c1)N1CCCC1 |
| InChI | InChI=1S/C19H23NO.CH4/c1-2-7-18(20-12-5-6-13-20)19(21)17-11-10-15-8-3-4-9-16(15)14-17;/h3-4,8-11,14,18H,2,5-7,12-13H2,1H3;1H4 |
| InChIKey | HVZQWYSIPZXFOV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |