ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate

C19H27NO3 — CID 6423083

IUPACethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate
SMILESCCCCC(C(=O)c1ccc(C(=O)OCC)cc1)N1CCCC1
InChIInChI=1S/C19H27NO3/c1-3-5-8-17(20-13-6-7-14-20)18(21)15-9-11-16(12-10-15)19(22)23-4-2/h9-12,17H,3-8,13-14H2,1-2H3
InChIKeyFDNPZAZPXFGMPZ-UHFFFAOYSA-N
MW317.43 g/mol
LogP3.70
Rot. Bonds8

About ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate

ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate (PubChem CID 6423083) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate.

Molecular Properties

Compound Nameethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate
PubChem CID6423083
Molecular FormulaC19H27NO3
Molecular Weight317.43 g/mol
Exact Mass317.20
IUPAC Nameethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate
SMILESCCCCC(C(=O)c1ccc(C(=O)OCC)cc1)N1CCCC1
InChIInChI=1S/C19H27NO3/c1-3-5-8-17(20-13-6-7-14-20)18(21)15-9-11-16(12-10-15)19(22)23-4-2/h9-12,17H,3-8,13-14H2,1-2H3
InChIKeyFDNPZAZPXFGMPZ-UHFFFAOYSA-N
XLogP3.70
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.43
LogP ≤ 53.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate?
The IUPAC name of ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate (CID 6423083) is ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate.
What is the SMILES notation for ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate?
The canonical SMILES for ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate is CCCCC(C(=O)c1ccc(C(=O)OCC)cc1)N1CCCC1.
What is the InChIKey of ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate?
The InChIKey is FDNPZAZPXFGMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-3-5-8-17(20-13-6-7-14-20)18(21)15-9-11-16(12-10-15)19(22)23-4-2/h9-12,17H,3-8,13-14H2,1-2H3.
What are the key properties of ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate?
ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate has a molecular weight of 317.43 g/mol, XLogP of 3.70, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-pyrrolidin-1-ylhexanoyl)benzoate is sourced from PubChem (CID 6423083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).