C12H26N4O — CID 114540686
4-(3,4,5-trimethylpiperazin-1-yl)pentanehydrazide (PubChem CID 114540686) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-(3,4,5-trimethylpiperazin-1-yl)pentanehydrazide.
| Compound Name | 4-(3,4,5-trimethylpiperazin-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 114540686 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 4-(3,4,5-trimethylpiperazin-1-yl)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C12H26N4O/c1-9(5-6-12(17)14-13)16-7-10(2)15(4)11(3)8-16/h9-11H,5-8,13H2,1-4H3,(H,14,17) |
| InChIKey | ITCVCRXEIYMEBW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|