C11H23N3O — CID 79183788
5-(3,4-dimethylpyrrolidin-1-yl)pentanehydrazide (PubChem CID 79183788) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-(3,4-dimethylpyrrolidin-1-yl)pentanehydrazide.
| Compound Name | 5-(3,4-dimethylpyrrolidin-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 79183788 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 5-(3,4-dimethylpyrrolidin-1-yl)pentanehydrazide |
| SMILES | CC1CN(CCCCC(=O)NN)CC1C |
| InChI | InChI=1S/C11H23N3O/c1-9-7-14(8-10(9)2)6-4-3-5-11(15)13-12/h9-10H,3-8,12H2,1-2H3,(H,13,15) |
| InChIKey | RKJWDINWRPIYCB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|