C12H26N6O2 — CID 23136143
3-[4-(3-hydrazinyl-3-oxopropyl)-2,5-dimethylpiperazin-1-yl]propanehydrazide (PubChem CID 23136143) has the molecular formula C12H26N6O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[4-(3-hydrazinyl-3-oxopropyl)-2,5-dimethylpiperazin-1-yl]propanehydrazide.
| Compound Name | 3-[4-(3-hydrazinyl-3-oxopropyl)-2,5-dimethylpiperazin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 23136143 |
| Molecular Formula | C12H26N6O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 3-[4-(3-hydrazinyl-3-oxopropyl)-2,5-dimethylpiperazin-1-yl]propanehydrazide |
| SMILES | CC1CN(CCC(=O)NN)C(C)CN1CCC(=O)NN |
| InChI | InChI=1S/C12H26N6O2/c1-9-7-18(6-4-12(20)16-14)10(2)8-17(9)5-3-11(19)15-13/h9-10H,3-8,13-14H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | VYVPYUHUNQEACC-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|