C25H43N3O6 — CID 171574259
2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 4-(2-methylaziridin-1-yl)butanoate (PubChem CID 171574259) has the molecular formula C25H43N3O6 and a molecular weight of 481.63 g/mol. Its IUPAC name is 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 4-(2-methylaziridin-1-yl)butanoate.
| Compound Name | 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 4-(2-methylaziridin-1-yl)butanoate |
|---|---|
| PubChem CID | 171574259 |
| Molecular Formula | C25H43N3O6 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 4-(2-methylaziridin-1-yl)butanoate |
| SMILES | CCC(COC(=O)CCCN1CC1C)(COC(=O)CCN1CC1C)COC(=O)CCN1CC1C |
| InChI | InChI=1S/C25H43N3O6/c1-5-25(17-33-23(30)8-11-27-14-20(27)3,18-34-24(31)9-12-28-15-21(28)4)16-32-22(29)7-6-10-26-13-19(26)2/h19-21H,5-18H2,1-4H3 |
| InChIKey | NTOZQTSDBLSJOO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|