C30H56O6 — CID 87353288
2,2-bis(6-methylheptanoyloxymethyl)butyl 6-methylheptanoate (PubChem CID 87353288) has the molecular formula C30H56O6 and a molecular weight of 512.77 g/mol. Its IUPAC name is 2,2-bis(6-methylheptanoyloxymethyl)butyl 6-methylheptanoate.
| Compound Name | 2,2-bis(6-methylheptanoyloxymethyl)butyl 6-methylheptanoate |
|---|---|
| PubChem CID | 87353288 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | 2,2-bis(6-methylheptanoyloxymethyl)butyl 6-methylheptanoate |
| SMILES | CCC(COC(=O)CCCCC(C)C)(COC(=O)CCCCC(C)C)COC(=O)CCCCC(C)C |
| InChI | InChI=1S/C30H56O6/c1-8-30(21-34-27(31)18-12-9-15-24(2)3,22-35-28(32)19-13-10-16-25(4)5)23-36-29(33)20-14-11-17-26(6)7/h24-26H,8-23H2,1-7H3 |
| InChIKey | INSFLYAAYAYLHS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|