C64H118O13 — CID 122221266
[3-(7-methyloctanoyloxy)-2-[[3-(7-methyloctanoyloxy)-2,2-bis(7-methyloctanoyloxymethyl)propoxy]methyl]-2-(7-methyloctanoyloxymethyl)propyl] 7-methyloctanoate (PubChem CID 122221266) has the molecular formula C64H118O13 and a molecular weight of 1095.63 g/mol. Its IUPAC name is [3-(7-methyloctanoyloxy)-2-[[3-(7-methyloctanoyloxy)-2,2-bis(7-methyloctanoyloxymethyl)propoxy]methyl]-2-(7-methyloctanoyloxymethyl)propyl] 7-methyloctanoate.
| Compound Name | [3-(7-methyloctanoyloxy)-2-[[3-(7-methyloctanoyloxy)-2,2-bis(7-methyloctanoyloxymethyl)propoxy]methyl]-2-(7-methyloctanoyloxymethyl)propyl] 7-methyloctanoate |
|---|---|
| PubChem CID | 122221266 |
| Molecular Formula | C64H118O13 |
| Molecular Weight | 1095.63 g/mol |
| Exact Mass | 1094.86 |
| IUPAC Name | [3-(7-methyloctanoyloxy)-2-[[3-(7-methyloctanoyloxy)-2,2-bis(7-methyloctanoyloxymethyl)propoxy]methyl]-2-(7-methyloctanoyloxymethyl)propyl] 7-methyloctanoate |
| SMILES | CC(C)CCCCCC(=O)OCC(COCC(COC(=O)CCCCCC(C)C)(COC(=O)CCCCCC(C)C)COC(=O)CCCCCC(C)C)(COC(=O)CCCCCC(C)C)COC(=O)CCCCCC(C)C |
| InChI | InChI=1S/C64H118O13/c1-51(2)31-19-13-25-37-57(65)72-45-63(46-73-58(66)38-26-14-20-32-52(3)4,47-74-59(67)39-27-15-21-33-53(5)6)43-71-44-64(48-75-60(68)40-28-16-22-34-54(7)8,49-76-61(69)41-29-17-23-35-55(9)10)50-77-62(70)42-30-18-24-36-56(11)12/h51-56H,13-50H2,1-12H3 |
| InChIKey | YFCBHBDVFNRPRQ-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.63 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|