C14H28O5 — CID 87644917
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 7-methyloctanoate (PubChem CID 87644917) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 7-methyloctanoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 7-methyloctanoate |
|---|---|
| PubChem CID | 87644917 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 7-methyloctanoate |
| SMILES | CC(C)CCCCCC(=O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C14H28O5/c1-12(2)6-4-3-5-7-13(18)19-11-14(8-15,9-16)10-17/h12,15-17H,3-11H2,1-2H3 |
| InChIKey | CVVYXKOJFHKFQT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|