C13H26O5 — CID 22628743
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 6-methylheptanoate (PubChem CID 22628743) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 6-methylheptanoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 6-methylheptanoate |
|---|---|
| PubChem CID | 22628743 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C13H26O5/c1-11(2)5-3-4-6-12(17)18-10-13(7-14,8-15)9-16/h11,14-16H,3-10H2,1-2H3 |
| InChIKey | QMYZTHQTTSETEI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|