C72H134O12 — CID 166582263
2,2-bis(9-butanoyloxyoctadecanoyloxymethyl)butyl 9-butanoyloxyoctadecanoate (PubChem CID 166582263) has the molecular formula C72H134O12 and a molecular weight of 1191.85 g/mol. Its IUPAC name is 2,2-bis(9-butanoyloxyoctadecanoyloxymethyl)butyl 9-butanoyloxyoctadecanoate.
| Compound Name | 2,2-bis(9-butanoyloxyoctadecanoyloxymethyl)butyl 9-butanoyloxyoctadecanoate |
|---|---|
| PubChem CID | 166582263 |
| Molecular Formula | C72H134O12 |
| Molecular Weight | 1191.85 g/mol |
| Exact Mass | 1190.99 |
| IUPAC Name | 2,2-bis(9-butanoyloxyoctadecanoyloxymethyl)butyl 9-butanoyloxyoctadecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)OCC(CC)(COC(=O)CCCCCCCC(CCCCCCCCC)OC(=O)CCC)COC(=O)CCCCCCCC(CCCCCCCCC)OC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C72H134O12/c1-8-15-18-21-24-30-39-51-63(82-69(76)48-11-4)54-42-33-27-36-45-57-66(73)79-60-72(14-7,61-80-67(74)58-46-37-28-34-43-55-64(83-70(77)49-12-5)52-40-31-25-22-19-16-9-2)62-81-68(75)59-47-38-29-35-44-56-65(84-71(78)50-13-6)53-41-32-26-23-20-17-10-3/h63-65H,8-62H2,1-7H3 |
| InChIKey | XOAMBPBIBJAFLE-UHFFFAOYSA-N |
| XLogP | 20.76 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.85 |
| LogP ≤ 5 | 20.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|