C66H122O12 — CID 166582209
2,2-bis(9-acetyloxyoctadecanoyloxymethyl)butyl 9-acetyloxyoctadecanoate (PubChem CID 166582209) has the molecular formula C66H122O12 and a molecular weight of 1107.69 g/mol. Its IUPAC name is 2,2-bis(9-acetyloxyoctadecanoyloxymethyl)butyl 9-acetyloxyoctadecanoate.
| Compound Name | 2,2-bis(9-acetyloxyoctadecanoyloxymethyl)butyl 9-acetyloxyoctadecanoate |
|---|---|
| PubChem CID | 166582209 |
| Molecular Formula | C66H122O12 |
| Molecular Weight | 1107.69 g/mol |
| Exact Mass | 1106.89 |
| IUPAC Name | 2,2-bis(9-acetyloxyoctadecanoyloxymethyl)butyl 9-acetyloxyoctadecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)OCC(CC)(COC(=O)CCCCCCCC(CCCCCCCCC)OC(C)=O)COC(=O)CCCCCCCC(CCCCCCCCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C66H122O12/c1-8-12-15-18-21-27-36-45-60(76-57(5)67)48-39-30-24-33-42-51-63(70)73-54-66(11-4,55-74-64(71)52-43-34-25-31-40-49-61(77-58(6)68)46-37-28-22-19-16-13-9-2)56-75-65(72)53-44-35-26-32-41-50-62(78-59(7)69)47-38-29-23-20-17-14-10-3/h60-62H,8-56H2,1-7H3 |
| InChIKey | DFYDFTCZRSYPRB-UHFFFAOYSA-N |
| XLogP | 18.42 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.69 |
| LogP ≤ 5 | 18.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|