C25H42N2O6 — CID 121403259
2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 3-(2-methylcyclopropyl)propanoate (PubChem CID 121403259) has the molecular formula C25H42N2O6 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 3-(2-methylcyclopropyl)propanoate.
| Compound Name | 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 3-(2-methylcyclopropyl)propanoate |
|---|---|
| PubChem CID | 121403259 |
| Molecular Formula | C25H42N2O6 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 3-(2-methylcyclopropyl)propanoate |
| SMILES | CCC(COC(=O)CCC1CC1C)(COC(=O)CCN1CC1C)COC(=O)CCN1CC1C |
| InChI | InChI=1S/C25H42N2O6/c1-5-25(15-31-22(28)7-6-21-12-18(21)2,16-32-23(29)8-10-26-13-19(26)3)17-33-24(30)9-11-27-14-20(27)4/h18-21H,5-17H2,1-4H3 |
| InChIKey | HIZJGGHLGNGVPK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|