C28H38Cl4O13 — CID 155594041
[2-[2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butoxymethyl]-2-[(4-chloro-4-oxobutanoyl)oxymethyl]butyl] 4-chloro-4-oxobutanoate (PubChem CID 155594041) has the molecular formula C28H38Cl4O13 and a molecular weight of 724.41 g/mol. Its IUPAC name is [2-[2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butoxymethyl]-2-[(4-chloro-4-oxobutanoyl)oxymethyl]butyl] 4-chloro-4-oxobutanoate.
| Compound Name | [2-[2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butoxymethyl]-2-[(4-chloro-4-oxobutanoyl)oxymethyl]butyl] 4-chloro-4-oxobutanoate |
|---|---|
| PubChem CID | 155594041 |
| Molecular Formula | C28H38Cl4O13 |
| Molecular Weight | 724.41 g/mol |
| Exact Mass | 722.11 |
| IUPAC Name | [2-[2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butoxymethyl]-2-[(4-chloro-4-oxobutanoyl)oxymethyl]butyl] 4-chloro-4-oxobutanoate |
| SMILES | CCC(COCC(CC)(COC(=O)CCC(=O)Cl)COC(=O)CCC(=O)Cl)(COC(=O)CCC(=O)Cl)COC(=O)CCC(=O)Cl |
| InChI | InChI=1S/C28H38Cl4O13/c1-3-27(15-42-23(37)9-5-19(29)33,16-43-24(38)10-6-20(30)34)13-41-14-28(4-2,17-44-25(39)11-7-21(31)35)18-45-26(40)12-8-22(32)36/h3-18H2,1-2H3 |
| InChIKey | HTEADACXOVYDIW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 182.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|