C15H27NO6 — CID 88951078
2,2-bis(oxiran-2-ylmethoxymethyl)butyl 3-aminopropanoate (PubChem CID 88951078) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2,2-bis(oxiran-2-ylmethoxymethyl)butyl 3-aminopropanoate.
| Compound Name | 2,2-bis(oxiran-2-ylmethoxymethyl)butyl 3-aminopropanoate |
|---|---|
| PubChem CID | 88951078 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2,2-bis(oxiran-2-ylmethoxymethyl)butyl 3-aminopropanoate |
| SMILES | CCC(COCC1CO1)(COCC1CO1)COC(=O)CCN |
| InChI | InChI=1S/C15H27NO6/c1-2-15(9-18-5-12-7-20-12,10-19-6-13-8-21-13)11-22-14(17)3-4-16/h12-13H,2-11,16H2,1H3 |
| InChIKey | UXJUSLNLLKAVDK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|