C35H70O17 — CID 88898601
2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]propoxy]methyl]oxirane (PubChem CID 88898601) has the molecular formula C35H70O17 and a molecular weight of 762.93 g/mol. Its IUPAC name is 2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]propoxy]methyl]oxirane.
| Compound Name | 2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]propoxy]methyl]oxirane |
|---|---|
| PubChem CID | 88898601 |
| Molecular Formula | C35H70O17 |
| Molecular Weight | 762.93 g/mol |
| Exact Mass | 762.46 |
| IUPAC Name | 2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]propoxy]methyl]oxirane |
| SMILES | COCCOCCOCCOCCOCC(COCCOCCOCCOCCOC)(COCCOCCOCCOCCOC)COCC1CO1 |
| InChI | InChI=1S/C35H70O17/c1-36-4-7-39-10-13-42-16-19-45-22-25-48-30-35(33-51-28-34-29-52-34,31-49-26-23-46-20-17-43-14-11-40-8-5-37-2)32-50-27-24-47-21-18-44-15-12-41-9-6-38-3/h34H,4-33H2,1-3H3 |
| InChIKey | YXNVYMQIRHZLFH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 160.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.93 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|