C13H22O6 — CID 161499535
2-[2,2-bis(oxiran-2-yloxymethyl)butoxymethyl]oxirane (PubChem CID 161499535) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-[2,2-bis(oxiran-2-yloxymethyl)butoxymethyl]oxirane.
| Compound Name | 2-[2,2-bis(oxiran-2-yloxymethyl)butoxymethyl]oxirane |
|---|---|
| PubChem CID | 161499535 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[2,2-bis(oxiran-2-yloxymethyl)butoxymethyl]oxirane |
| SMILES | CCC(COCC1CO1)(COC1CO1)COC1CO1 |
| InChI | InChI=1S/C13H22O6/c1-2-13(8-18-11-5-16-11,9-19-12-6-17-12)7-14-3-10-4-15-10/h10-12H,2-9H2,1H3 |
| InChIKey | PIEUTPKUGMCMSV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|