C17H34O5 — CID 146626109
2-[[2-(2-methoxyethoxymethyl)-2-(2-methylbutoxymethyl)butoxy]methyl]oxirane (PubChem CID 146626109) has the molecular formula C17H34O5 and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[[2-(2-methoxyethoxymethyl)-2-(2-methylbutoxymethyl)butoxy]methyl]oxirane.
| Compound Name | 2-[[2-(2-methoxyethoxymethyl)-2-(2-methylbutoxymethyl)butoxy]methyl]oxirane |
|---|---|
| PubChem CID | 146626109 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2-[[2-(2-methoxyethoxymethyl)-2-(2-methylbutoxymethyl)butoxy]methyl]oxirane |
| SMILES | CCC(C)COCC(CC)(COCCOC)COCC1CO1 |
| InChI | InChI=1S/C17H34O5/c1-5-15(3)9-20-13-17(6-2,12-19-8-7-18-4)14-21-10-16-11-22-16/h15-16H,5-14H2,1-4H3 |
| InChIKey | QVVCNDPSDKBCHI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|