C21H43BrO9 — CID 163522489
2-[2-(2-bromoethoxy)ethoxy]-1-(2-methoxyethoxy)propane;2-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethoxymethyl]oxirane (PubChem CID 163522489) has the molecular formula C21H43BrO9 and a molecular weight of 519.47 g/mol. Its IUPAC name is 2-[2-(2-bromoethoxy)ethoxy]-1-(2-methoxyethoxy)propane;2-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethoxymethyl]oxirane.
| Compound Name | 2-[2-(2-bromoethoxy)ethoxy]-1-(2-methoxyethoxy)propane;2-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 163522489 |
| Molecular Formula | C21H43BrO9 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[2-(2-bromoethoxy)ethoxy]-1-(2-methoxyethoxy)propane;2-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethoxymethyl]oxirane |
| SMILES | COCCOCC(C)OCCOCC1CO1.COCCOCC(C)OCCOCCBr |
| InChI | InChI=1S/C11H22O5.C10H21BrO4/c1-10(7-13-4-3-12-2)15-6-5-14-8-11-9-16-11;1-10(9-14-6-5-12-2)15-8-7-13-4-3-11/h10-11H,3-9H2,1-2H3;10H,3-9H2,1-2H3 |
| InChIKey | DMAQQGLDUKQHOK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|