C11H22O3 — CID 167130751
2-[3-(2-methylbutoxy)propoxymethyl]oxirane (PubChem CID 167130751) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-[3-(2-methylbutoxy)propoxymethyl]oxirane.
| Compound Name | 2-[3-(2-methylbutoxy)propoxymethyl]oxirane |
|---|---|
| PubChem CID | 167130751 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-[3-(2-methylbutoxy)propoxymethyl]oxirane |
| SMILES | CCC(C)COCCCOCC1CO1 |
| InChI | InChI=1S/C11H22O3/c1-3-10(2)7-12-5-4-6-13-8-11-9-14-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | KHDBMXDGUXKYCY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|