C20H38O4 — CID 142609718
2-[[2,6,10-trimethyl-11-(oxiran-2-ylmethoxy)undecoxy]methyl]oxirane (PubChem CID 142609718) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[[2,6,10-trimethyl-11-(oxiran-2-ylmethoxy)undecoxy]methyl]oxirane.
| Compound Name | 2-[[2,6,10-trimethyl-11-(oxiran-2-ylmethoxy)undecoxy]methyl]oxirane |
|---|---|
| PubChem CID | 142609718 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-[[2,6,10-trimethyl-11-(oxiran-2-ylmethoxy)undecoxy]methyl]oxirane |
| SMILES | CC(CCCC(C)COCC1CO1)CCCC(C)COCC1CO1 |
| InChI | InChI=1S/C20H38O4/c1-16(6-4-8-17(2)10-21-12-19-14-23-19)7-5-9-18(3)11-22-13-20-15-24-20/h16-20H,4-15H2,1-3H3 |
| InChIKey | JXZNNGOYYGOMGI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|