About bis(2-methylhexyl) oxiran-2-ylmethyl phosphate
bis(2-methylhexyl) oxiran-2-ylmethyl phosphate (PubChem CID 71330005) has the molecular formula C17H35O5P
and a molecular weight of 350.44 g/mol. Its IUPAC name is bis(2-methylhexyl) oxiran-2-ylmethyl phosphate.
Molecular Properties
| Compound Name | bis(2-methylhexyl) oxiran-2-ylmethyl phosphate |
| PubChem CID | 71330005 |
| Molecular Formula | C17H35O5P |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | bis(2-methylhexyl) oxiran-2-ylmethyl phosphate |
| SMILES | CCCCC(C)COP(=O)(OCC(C)CCCC)OCC1CO1 |
| InChI | InChI=1S/C17H35O5P/c1-5-7-9-15(3)11-20-23(18,22-14-17-13-19-17)21-12-16(4)10-8-6-2/h15-17H,5-14H2,1-4H3 |
| InChIKey | CTVZMKRSLREXNB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylhexyl) oxiran-2-ylmethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylhexyl) oxiran-2-ylmethyl phosphate?
The IUPAC name of bis(2-methylhexyl) oxiran-2-ylmethyl phosphate (CID 71330005) is bis(2-methylhexyl) oxiran-2-ylmethyl phosphate.
What is the SMILES notation for bis(2-methylhexyl) oxiran-2-ylmethyl phosphate?
The canonical SMILES for bis(2-methylhexyl) oxiran-2-ylmethyl phosphate is CCCCC(C)COP(=O)(OCC(C)CCCC)OCC1CO1.
What is the InChIKey of bis(2-methylhexyl) oxiran-2-ylmethyl phosphate?
The InChIKey is CTVZMKRSLREXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35O5P/c1-5-7-9-15(3)11-20-23(18,22-14-17-13-19-17)21-12-16(4)10-8-6-2/h15-17H,5-14H2,1-4H3.
What are the key properties of bis(2-methylhexyl) oxiran-2-ylmethyl phosphate?
bis(2-methylhexyl) oxiran-2-ylmethyl phosphate has a molecular weight of 350.44 g/mol, XLogP of 5.20, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylhexyl) oxiran-2-ylmethyl phosphate is sourced from PubChem (CID 71330005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).