C9H19O6P — CID 11972014
diethyl (2-methyl-1,3-dioxolan-4-yl)methyl phosphate (PubChem CID 11972014) has the molecular formula C9H19O6P and a molecular weight of 254.22 g/mol. Its IUPAC name is diethyl (2-methyl-1,3-dioxolan-4-yl)methyl phosphate.
| Compound Name | diethyl (2-methyl-1,3-dioxolan-4-yl)methyl phosphate |
|---|---|
| PubChem CID | 11972014 |
| Molecular Formula | C9H19O6P |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | diethyl (2-methyl-1,3-dioxolan-4-yl)methyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC1COC(C)O1 |
| InChI | InChI=1S/C9H19O6P/c1-4-12-16(10,13-5-2)14-7-9-6-11-8(3)15-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | MYEIFXHRECDKPQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|