C5H10O3 — CID 12832915
[(2R,4R)-2-methyl-1,3-dioxolan-4-yl]methanol (PubChem CID 12832915) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is [(2R,4R)-2-methyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(2R,4R)-2-methyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 12832915 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | [(2R,4R)-2-methyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@@H]1OC[C@@H](CO)O1 |
| InChI | InChI=1S/C5H10O3/c1-4-7-3-5(2-6)8-4/h4-6H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | ZCYJBTKNPHKPPN-RFZPGFLSSA-N |
| XLogP | -0.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |