C10H20O3 — CID 145109293
[2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane (PubChem CID 145109293) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane.
| Compound Name | [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane |
|---|---|
| PubChem CID | 145109293 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane |
| SMILES | C/C=C(\C)C1OCC(CO)O1.CC |
| InChI | InChI=1S/C8H14O3.C2H6/c1-3-6(2)8-10-5-7(4-9)11-8;1-2/h3,7-9H,4-5H2,1-2H3;1-2H3/b6-3+; |
| InChIKey | QPWLMYBLVSCLMP-ZIKNSQGESA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|