About [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane
[2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane (PubChem CID 145109293) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane.
Molecular Properties
| Compound Name | [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane |
| PubChem CID | 145109293 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane |
| SMILES | C/C=C(\C)C1OCC(CO)O1.CC |
| InChI | InChI=1S/C8H14O3.C2H6/c1-3-6(2)8-10-5-7(4-9)11-8;1-2/h3,7-9H,4-5H2,1-2H3;1-2H3/b6-3+; |
| InChIKey | QPWLMYBLVSCLMP-ZIKNSQGESA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane?
The IUPAC name of [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane (CID 145109293) is [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane.
What is the SMILES notation for [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane?
The canonical SMILES for [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane is C/C=C(\C)C1OCC(CO)O1.CC.
What is the InChIKey of [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane?
The InChIKey is QPWLMYBLVSCLMP-ZIKNSQGESA-N. The full InChI is InChI=1S/C8H14O3.C2H6/c1-3-6(2)8-10-5-7(4-9)11-8;1-2/h3,7-9H,4-5H2,1-2H3;1-2H3/b6-3+;.
What are the key properties of [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane?
[2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane has a molecular weight of 188.27 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(E)-but-2-en-2-yl]-1,3-dioxolan-4-yl]methanol;ethane is sourced from PubChem (CID 145109293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).