C6H10O2 — CID 123232646
2-but-2-en-2-yl-1,3-dioxetane (PubChem CID 123232646) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 2-but-2-en-2-yl-1,3-dioxetane.
| Compound Name | 2-but-2-en-2-yl-1,3-dioxetane |
|---|---|
| PubChem CID | 123232646 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2-but-2-en-2-yl-1,3-dioxetane |
| SMILES | CC=C(C)C1OCO1 |
| InChI | InChI=1S/C6H10O2/c1-3-5(2)6-7-4-8-6/h3,6H,4H2,1-2H3 |
| InChIKey | PKHUGENIMGRMLL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|