C11H18O2 — CID 163802098
6-[(E)-but-2-en-2-yl]-3-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (PubChem CID 163802098) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 6-[(E)-but-2-en-2-yl]-3-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan.
| Compound Name | 6-[(E)-but-2-en-2-yl]-3-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
|---|---|
| PubChem CID | 163802098 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 6-[(E)-but-2-en-2-yl]-3-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| SMILES | C/C=C(\C)C1OCC2C(C)OCC12 |
| InChI | InChI=1S/C11H18O2/c1-4-7(2)11-10-6-12-8(3)9(10)5-13-11/h4,8-11H,5-6H2,1-3H3/b7-4+ |
| InChIKey | NFWPZQVSVHRRMB-QPJJXVBHSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|