About 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan
4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (PubChem CID 167015237) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan.
Analyze 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan?
The IUPAC name of 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (CID 167015237) is 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan.
What is the SMILES notation for 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan?
The canonical SMILES for 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan is CC1OCC2COCC21.
What is the InChIKey of 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan?
The InChIKey is NZYUZEFQCUAAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-5-7-4-8-2-6(7)3-9-5/h5-7H,2-4H2,1H3.
What are the key properties of 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan?
4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan has a molecular weight of 128.17 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan is sourced from PubChem (CID 167015237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).