C11H20O — CID 67031672
3-methyl-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]furan (PubChem CID 67031672) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-methyl-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]furan.
| Compound Name | 3-methyl-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]furan |
|---|---|
| PubChem CID | 67031672 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3-methyl-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]furan |
| SMILES | CC1OCC2CCCCCCC21 |
| InChI | InChI=1S/C11H20O/c1-9-11-7-5-3-2-4-6-10(11)8-12-9/h9-11H,2-8H2,1H3 |
| InChIKey | ZSJLLQAGDKGCCA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |