C17H30 — CID 59124996
5-cyclohexyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene (PubChem CID 59124996) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 5-cyclohexyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene.
| Compound Name | 5-cyclohexyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene |
|---|---|
| PubChem CID | 59124996 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 5-cyclohexyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene |
| SMILES | C1CCC(C2CCCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C17H30/c1-2-8-14(9-3-1)16-12-6-4-10-15-11-5-7-13-17(15)16/h14-17H,1-13H2 |
| InChIKey | DLDQSDNJMMOIBX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |