C18H40 — CID 159429380
1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;methane (PubChem CID 159429380) has the molecular formula C18H40 and a molecular weight of 256.52 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;methane.
| Compound Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;methane |
|---|---|
| PubChem CID | 159429380 |
| Molecular Formula | C18H40 |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 256.31 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;methane |
| SMILES | C.C.C.C.C1CCC2C(C1)CCC1CCCCC12 |
| InChI | InChI=1S/C14H24.4CH4/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;;;;/h11-14H,1-10H2;4*1H4 |
| InChIKey | LQUDUEMOZOJHCA-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |