About CID 143043370
CID 143043370 (PubChem CID 143043370) has the molecular formula C13H23
and a molecular weight of 179.33 g/mol.
Molecular Properties
| Compound Name | CID 143043370 |
| PubChem CID | 143043370 |
| Molecular Formula | C13H23 |
| Molecular Weight | 179.33 g/mol |
| Exact Mass | 179.18 |
| IUPAC Name | — |
| SMILES | [CH2]C1CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C13H23/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12/h11-13H,1-10H2 |
| InChIKey | GSMLTMMXGAGVRN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 143043370 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143043370?
The IUPAC name of CID 143043370 (CID 143043370) is not available.
What is the SMILES notation for CID 143043370?
The canonical SMILES for CID 143043370 is [CH2]C1CCCCC1C1CCCCC1.
What is the InChIKey of CID 143043370?
The InChIKey is GSMLTMMXGAGVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12/h11-13H,1-10H2.
What are the key properties of CID 143043370?
CID 143043370 has a molecular weight of 179.33 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143043370 is sourced from PubChem (CID 143043370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).