C17H32 — CID 90841263
(1S,2S,3aR,7aR)-1,2-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;cyclohexane (PubChem CID 90841263) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is (1S,2S,3aR,7aR)-1,2-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;cyclohexane.
| Compound Name | (1S,2S,3aR,7aR)-1,2-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;cyclohexane |
|---|---|
| PubChem CID | 90841263 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | (1S,2S,3aR,7aR)-1,2-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;cyclohexane |
| SMILES | C1CCCCC1.C[C@@H]1[C@@H]2CCCC[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C11H20.C6H12/c1-8-7-10-5-3-4-6-11(10)9(8)2;1-2-4-6-5-3-1/h8-11H,3-7H2,1-2H3;1-6H2/t8-,9-,10+,11-;/m0./s1 |
| InChIKey | ISQCBISXVDQMOQ-CWXCEVAHSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |