2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid

C12H20O2 — CID 178190225

IUPAC2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid
SMILESCC1CC2CCCCCC2C1C(=O)O
InChIInChI=1S/C12H20O2/c1-8-7-9-5-3-2-4-6-10(9)11(8)12(13)14/h8-11H,2-7H2,1H3,(H,13,14)
InChIKeyUSMKCPKECWDQDG-UHFFFAOYSA-N
MW196.29 g/mol
LogP2.92
Rot. Bonds1

About 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid

2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid (PubChem CID 178190225) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid.

Molecular Properties

Compound Name2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid
PubChem CID178190225
Molecular FormulaC12H20O2
Molecular Weight196.29 g/mol
Exact Mass196.15
IUPAC Name2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid
SMILESCC1CC2CCCCCC2C1C(=O)O
InChIInChI=1S/C12H20O2/c1-8-7-9-5-3-2-4-6-10(9)11(8)12(13)14/h8-11H,2-7H2,1H3,(H,13,14)
InChIKeyUSMKCPKECWDQDG-UHFFFAOYSA-N
XLogP2.92
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.29
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid?
The IUPAC name of 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid (CID 178190225) is 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid.
What is the SMILES notation for 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid?
The canonical SMILES for 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid is CC1CC2CCCCCC2C1C(=O)O.
What is the InChIKey of 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid?
The InChIKey is USMKCPKECWDQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-8-7-9-5-3-2-4-6-10(9)11(8)12(13)14/h8-11H,2-7H2,1H3,(H,13,14).
What are the key properties of 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid?
2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid has a molecular weight of 196.29 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1-carboxylic acid is sourced from PubChem (CID 178190225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).