C20H34O2 — CID 91447754
(2S,3R,5S)-3,5-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid;(2S,3S,5S)-2,3,5-trimethylbicyclo[2.2.1]heptane (PubChem CID 91447754) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (2S,3R,5S)-3,5-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid;(2S,3S,5S)-2,3,5-trimethylbicyclo[2.2.1]heptane.
| Compound Name | (2S,3R,5S)-3,5-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid;(2S,3S,5S)-2,3,5-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 91447754 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (2S,3R,5S)-3,5-dimethylbicyclo[2.2.1]heptane-2-carboxylic acid;(2S,3S,5S)-2,3,5-trimethylbicyclo[2.2.1]heptane |
| SMILES | C[C@@H]1C2CC(C[C@@H]2C)[C@@H]1C.C[C@@H]1C2CC(C[C@@H]2C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H16O2.C10H18/c1-5-3-7-4-8(5)6(2)9(7)10(11)12;1-6-4-9-5-10(6)8(3)7(9)2/h5-9H,3-4H2,1-2H3,(H,11,12);6-10H,4-5H2,1-3H3/t5-,6+,7?,8?,9+;6-,7+,8-,9?,10?/m00/s1 |
| InChIKey | GNAONOZPGCMRBM-XIXUDLEYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |