C42H72O6 — CID 91144013
tert-butyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 91144013) has the molecular formula C42H72O6 and a molecular weight of 673.03 g/mol. Its IUPAC name is tert-butyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91144013 |
| Molecular Formula | C42H72O6 |
| Molecular Weight | 673.03 g/mol |
| Exact Mass | 672.53 |
| IUPAC Name | tert-butyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OC(C)(C)C)C(C2)C1C.CC1C2CC(C(=O)OC(C)(C)C)C(C2)C1C.CC1C2CC(C(=O)OC(C)(C)C)C(C2)C1C |
| InChI | InChI=1S/3C14H24O2/c3*1-8-9(2)11-6-10(8)7-12(11)13(15)16-14(3,4)5/h3*8-12H,6-7H2,1-5H3 |
| InChIKey | QUBIHVXGKPMPEK-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.03 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|