About methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate
methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 158545262) has the molecular formula C22H40O3
and a molecular weight of 352.56 g/mol. Its IUPAC name is methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 158545262 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C.C.CC1CCC(C(C)(C)OC(=O)C2CC3CC2C(C)C3C)C(=O)C1 |
| InChI | InChI=1S/C20H32O3.2CH4/c1-11-6-7-17(18(21)8-11)20(4,5)23-19(22)16-10-14-9-15(16)13(3)12(14)2;;/h11-17H,6-10H2,1-5H3;2*1H4 |
| InChIKey | HPAMJHPCGBQKQU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (CID 158545262) is methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate is C.C.CC1CCC(C(C)(C)OC(=O)C2CC3CC2C(C)C3C)C(=O)C1.
What is the InChIKey of methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is HPAMJHPCGBQKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3.2CH4/c1-11-6-7-17(18(21)8-11)20(4,5)23-19(22)16-10-14-9-15(16)13(3)12(14)2;;/h11-17H,6-10H2,1-5H3;2*1H4.
What are the key properties of methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate?
methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 352.56 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(4-methyl-2-oxocyclohexyl)propan-2-yl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 158545262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).