C13H22O3 — CID 59366082
3-hydroxypropyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59366082) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-hydroxypropyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3-hydroxypropyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59366082 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3-hydroxypropyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCCCO)C(C2)C1C |
| InChI | InChI=1S/C13H22O3/c1-8-9(2)11-6-10(8)7-12(11)13(15)16-5-3-4-14/h8-12,14H,3-7H2,1-2H3 |
| InChIKey | FUBKWNCYYFVJFN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|