C16H21F7O2 — CID 89254742
2,2,3,3,4,4,5-heptafluorohexyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 89254742) has the molecular formula C16H21F7O2 and a molecular weight of 378.33 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluorohexyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2,2,3,3,4,4,5-heptafluorohexyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89254742 |
| Molecular Formula | C16H21F7O2 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluorohexyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(C)F)C(C2)C1C |
| InChI | InChI=1S/C16H21F7O2/c1-7-8(2)11-4-10(7)5-12(11)13(24)25-6-14(18,19)16(22,23)15(20,21)9(3)17/h7-12H,4-6H2,1-3H3 |
| InChIKey | AKAGJPFOZMOIOT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|