C13H12F8O2 — CID 59126194
2,2,3,3,4,4,5,5-octafluoropentyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59126194) has the molecular formula C13H12F8O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59126194 |
| Molecular Formula | C13H12F8O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H12F8O2/c14-10(15)12(18,19)13(20,21)11(16,17)5-23-9(22)8-4-6-1-2-7(8)3-6/h1-2,6-8,10H,3-5H2 |
| InChIKey | ZTTLOCSVTCWQKX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|