C12H12F8 — CID 88896278
5-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 88896278) has the molecular formula C12H12F8 and a molecular weight of 308.21 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 88896278 |
| Molecular Formula | C12H12F8 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H12F8/c13-9(14)11(17,18)12(19,20)10(15,16)5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2 |
| InChIKey | CBHGEKHDBGHZBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|