C14H26O — CID 158426911
5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane (PubChem CID 158426911) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane.
| Compound Name | 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane |
|---|---|
| PubChem CID | 158426911 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane |
| SMILES | CC(C)(C)CC1CC2C=CC1C2.COC |
| InChI | InChI=1S/C12H20.C2H6O/c1-12(2,3)8-11-7-9-4-5-10(11)6-9;1-3-2/h4-5,9-11H,6-8H2,1-3H3;1-2H3 |
| InChIKey | HBDWHORODNHYSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|