About 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane
5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane (PubChem CID 158426911) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane |
| PubChem CID | 158426911 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane |
| SMILES | CC(C)(C)CC1CC2C=CC1C2.COC |
| InChI | InChI=1S/C12H20.C2H6O/c1-12(2,3)8-11-7-9-4-5-10(11)6-9;1-3-2/h4-5,9-11H,6-8H2,1-3H3;1-2H3 |
| InChIKey | HBDWHORODNHYSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane?
The IUPAC name of 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane (CID 158426911) is 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane.
What is the SMILES notation for 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane?
The canonical SMILES for 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane is CC(C)(C)CC1CC2C=CC1C2.COC.
What is the InChIKey of 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane?
The InChIKey is HBDWHORODNHYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20.C2H6O/c1-12(2,3)8-11-7-9-4-5-10(11)6-9;1-3-2/h4-5,9-11H,6-8H2,1-3H3;1-2H3.
What are the key properties of 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane?
5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane has a molecular weight of 210.36 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropyl)bicyclo[2.2.1]hept-2-ene;methoxymethane is sourced from PubChem (CID 158426911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).