C12H20Cl2Si — CID 123972644
[4-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-dichloro-2-methylbutan-2-yl]silane (PubChem CID 123972644) has the molecular formula C12H20Cl2Si and a molecular weight of 263.28 g/mol. Its IUPAC name is [4-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-dichloro-2-methylbutan-2-yl]silane.
| Compound Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-dichloro-2-methylbutan-2-yl]silane |
|---|---|
| PubChem CID | 123972644 |
| Molecular Formula | C12H20Cl2Si |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-dichloro-2-methylbutan-2-yl]silane |
| SMILES | CC(C)([SiH3])C(Cl)(Cl)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H20Cl2Si/c1-11(2,15)12(13,14)7-10-6-8-3-4-9(10)5-8/h3-4,8-10H,5-7H2,1-2,15H3 |
| InChIKey | JUMUFORDVVMRBV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|