C9H14 — CID 96570682
(1S,4S,5R)-5-ethylbicyclo[2.2.1]hept-2-ene (PubChem CID 96570682) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is (1S,4S,5R)-5-ethylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5R)-5-ethylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 96570682 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (1S,4S,5R)-5-ethylbicyclo[2.2.1]hept-2-ene |
| SMILES | CC[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H14/c1-2-8-5-7-3-4-9(8)6-7/h3-4,7-9H,2,5-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | QHJIJNGGGLNBNJ-YIZRAAEISA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|