C8H11Br — CID 99137828
(1S,4R,5S)-5-(bromomethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 99137828) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is (1S,4R,5S)-5-(bromomethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5S)-5-(bromomethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 99137828 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (1S,4R,5S)-5-(bromomethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | BrC[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C8H11Br/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | XCDJEPZLSGMJSM-BIIVOSGPSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|