C12H21NO2 — CID 677824
2-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 677824) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 677824 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)C[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H21NO2/c14-5-3-13(4-6-15)9-12-8-10-1-2-11(12)7-10/h1-2,10-12,14-15H,3-9H2/t10-,11+,12-/m1/s1 |
| InChIKey | QCDJMILMRVINOZ-GRYCIOLGSA-N |
| XLogP | 0.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|