C9H15N — CID 98147464
2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethanamine (PubChem CID 98147464) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethanamine.
| Compound Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethanamine |
|---|---|
| PubChem CID | 98147464 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethanamine |
| SMILES | NCC[C@@H]1C[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H15N/c10-4-3-9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6,10H2/t7-,8-,9-/m1/s1 |
| InChIKey | IGRYFUUCWNBVDN-IWSPIJDZSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|