C13H22 — CID 97304116
(1S,4S,5S)-5-hexylbicyclo[2.2.1]hept-2-ene (PubChem CID 97304116) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (1S,4S,5S)-5-hexylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5S)-5-hexylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 97304116 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (1S,4S,5S)-5-hexylbicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCCC[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H22/c1-2-3-4-5-6-12-9-11-7-8-13(12)10-11/h7-8,11-13H,2-6,9-10H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | WMWDGZLDLRCDRG-AVGNSLFASA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|