C19H30O2 — CID 142112482
2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)propan-2-ol;5-methylbicyclo[2.2.1]hept-2-ene (PubChem CID 142112482) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)propan-2-ol;5-methylbicyclo[2.2.1]hept-2-ene.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)propan-2-ol;5-methylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 142112482 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)propan-2-ol;5-methylbicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)(O)OCC1CC2C=CC1C2.CC1CC2C=CC1C2 |
| InChI | InChI=1S/C11H18O2.C8H12/c1-11(2,12)13-7-10-6-8-3-4-9(10)5-8;1-6-4-7-2-3-8(6)5-7/h3-4,8-10,12H,5-7H2,1-2H3;2-3,6-8H,4-5H2,1H3 |
| InChIKey | XHYQDXBJMKRCHX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|