C13H18O — CID 98153361
5-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol (PubChem CID 98153361) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol.
| Compound Name | 5-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol |
|---|---|
| PubChem CID | 98153361 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol |
| SMILES | CC(C)(O)C#CC[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H18O/c1-13(2,14)7-3-4-11-8-10-5-6-12(11)9-10/h5-6,10-12,14H,4,8-9H2,1-2H3/t10-,11+,12+/m1/s1 |
| InChIKey | VIDVELXKOPAIMM-WOPDTQHZSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|